
Catalog Number	AR00ECB2
Chemical Name	CP 640186
CAS Number	591778-68-6
Molecular Formula	C30H35N3O3
Molecular Weight	485.6172
MDL Number	MFCD25976696
SMILES	O=C(N1CCOCC1)[C@@H]1CCCN(C1)C1CCN(CC1)C(=O)c1c2ccccc2cc2c1cccc2

Cp-640186 is a versatile compound that plays a crucial role in various chemical synthesis processes. Known for its exceptional reactivity and selectivity, Cp-640186 is widely used as a key building block in the creation of complex organic molecules. Its unique structural properties make it a valuable tool in the development of novel pharmaceuticals, agrochemicals, and materials. Chemists rely on Cp-640186 to facilitate challenging chemical transformations, such as carbon-carbon bond formations and functional group interconversions. With its impressive performance and reliability, Cp-640186 continues to drive innovation and advancement in the field of organic synthesis.