
Catalog Number	AR0035QJ
Chemical Name	2-Propenoic acid, (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester, rel-
CAS Number	5888-33-5
Molecular Formula	C13H20O2
Molecular Weight	208.2967
MDL Number	MFCD07995056
SMILES	C=CC(=O)O[C@@H]1C[C@@H]2C([C@@]1(C)CC2)(C)C

In chemical synthesis, 2-Propenoic acid, (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester, rel- is utilized as a versatile building block for creating complex organic compounds. Its unique structure allows for the formation of diverse molecular architectures, making it a valuable tool for the construction of pharmaceuticals, agrochemicals, and materials. The presence of the bicyclic heptene moiety confers stereochemical control, enabling precise manipulation of chiral centers in the target molecules. Additionally, the acrylate functionality of 2-Propenoic acid facilitates efficient transformations in various types of reactions, contributing to the efficiency and selectivity of the synthetic routes. This compound plays a crucial role in the strategic design and assembly of intricate chemical structures, making it an indispensable asset in modern organic synthesis.