
Catalog Number	AR00E9NT
Chemical Name	Toosendanin
CAS Number	58812-37-6
Molecular Formula	C30H38O11
Molecular Weight	574.6161
MDL Number	MFCD00210564
SMILES	CC(=O)O[C@H]1C(=O)[C@@H]2[C@@]34CO[C@H]([C@]([C@@H]4C[C@H]([C@]2([C@@]24[C@]1(C)[C@@H](C[C@H]4O2)c1ccoc1)C)O)([C@@H](C[C@@H]3O)OC(=O)C)C)O

Toosendanin, a natural product derived from the Melia toosendan tree, has found significant application in chemical synthesis as a versatile building block. Its unique structure and reactivity make it an ideal starting material for the synthesis of various pharmacologically active compounds. By leveraging the distinctive chemical properties of toosendanin, chemists can efficiently access complex molecular frameworks that serve as key intermediates in the development of novel drugs and agrochemicals. The ability of toosendanin to undergo diverse chemical transformations, such as functional group interconversions and ring-closure reactions, offers a strategic advantage in the synthesis of biologically active molecules with enhanced potency and specificity. Furthermore, the presence of multiple reactive sites in the toosendanin molecule enables selective modification, allowing for the creation of structurally diverse compound libraries for drug discovery and material science applications. Through the strategic utilization of toosendanin in synthetic routes, chemists can expedite the preparation of valuable compounds with potential therapeutic and industrial applications.