
Catalog Number	AR01EOEE
Chemical Name	Bradykinin
CAS Number	58-82-2
Molecular Formula	C50H73N15O11
Molecular Weight	1060.2085
MDL Number	MFCD00076258
SMILES	OC[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCCNC(=N)N)Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)N

Bradykinin is a bioactive peptide that plays a crucial role in various chemical synthesis processes. This peptide is often utilized in the field of organic chemistry, particularly in the synthesis of peptide-based drugs and pharmaceuticals. Due to its ability to interact with protein receptors and enzymes, bradykinin serves as a valuable tool for studying molecular interactions and designing new therapeutic agents. In addition, bradykinin can be employed as a chemical reagent for specific reactions in the synthesis of complex organic molecules. Its versatile properties make it a key component in the development of innovative synthetic strategies for drug discovery and medicinal chemistry.