
Catalog Number	AR00IAW7
Chemical Name	N-[(2R)-1-(dipropylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]benzamide
CAS Number	57227-09-5
Molecular Formula	C22H28N2O3
Molecular Weight	368.4693
MDL Number	MFCD08063358
SMILES	CCCN(C(=O)C(NC(=O)c1ccccc1)Cc1ccc(cc1)O)CCC

N-(1-(Dipropylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)benzamide, a versatile compound utilized in chemical synthesis, serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and materials. By incorporating this compound into synthetic pathways, chemists can effectively introduce the dipropylamino and hydroxyphenyl functionalities into their target molecules, enhancing the biological activity or material properties of the final products. Furthermore, the presence of the benzamide moiety enables precise structural modifications, allowing for the fine-tuning of desired properties. In modern chemical synthesis, the strategic utilization of N-(1-(Dipropylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)benzamide facilitates the efficient construction of diverse and complex molecular architectures, paving the way for advancements in the fields of medicine, agriculture, and materials science.