
Catalog Number	AR00EDP4
Chemical Name	3-Amino-L-Phenylalanine
CAS Number	57213-16-8
Molecular Formula	C9H12N2O2
Molecular Weight	180.2038
MDL Number	MFCD09836123
SMILES	OC(=O)[C@H](Cc1cccc(c1)N)N

(S)-2-Amino-3-(3-aminophenyl)propanoic acid, also known as $name$, is a valuable compound in chemical synthesis due to its versatile applications. It serves as a key building block in the production of various pharmaceuticals, organic compounds, and specialized materials. Specifically, (S)-2-Amino-3-(3-aminophenyl)propanoic acid is often used as a chiral intermediate in the synthesis of complex molecules, allowing for the creation of enantiomerically pure compounds with specific biological activities or properties. Additionally, this compound can serve as a precursor in the preparation of peptide-based drugs, which are important in the field of medicine and biotechnology. Moreover, the unique structural features of (S)-2-Amino-3-(3-aminophenyl)propanoic acid make it an essential component in the development of novel materials with tailored properties for various industrial applications.