
Catalog Number	AR00EAAO
Chemical Name	Paxilline
CAS Number	57186-25-1
Molecular Formula	C27H33NO4
Molecular Weight	435.5552
MDL Number	MFCD00083464
SMILES	O=C1C=C2C(OC1C(O)(C)C)CCC1(C2(O)CCC2C1(C)c1[nH]c3c(c1C2)cccc3)C

Paxilline is a naturally occurring indole-tetramic acid alkaloid that is widely used in chemical synthesis for its unique structural features and versatile reactivity. In organic chemistry, Paxilline serves as a valuable building block for the synthesis of various bioactive compounds and pharmaceutical agents. Its complex molecular structure allows for the introduction of functional groups and stereochemical modifications, making it an essential reagent in the creation of diverse chemical libraries for drug discovery and development. Additionally, Paxilline's ability to undergo selective transformations under mild reaction conditions further enhances its utility in the field of chemical synthesis, enabling the efficient construction of complex molecular scaffolds with high levels of control and precision.