
Catalog Number	AR003E4W
Chemical Name	1,3,4,6-TETRA-O-ACETYL-2-AZIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSE
CAS Number	56883-33-1
Molecular Formula	C14H19N3O9
Molecular Weight	373.31536
MDL Number	MFCD01076183
SMILES	[N-]=[N+]=N[C@H]1[C@@H](OC(=O)C)O[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)COC(=O)C

1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. This compound serves as a key building block in the preparation of various glycosidic linkages, making it essential in carbohydrate chemistry and the synthesis of complex natural products.In chemical synthesis, 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose acts as a glycosylation reagent, enabling the formation of glycosidic bonds through the activation of the anomeric carbon. This compound is particularly valuable in the efficient and selective synthesis of oligosaccharides, glycopeptides, and glycolipids.Furthermore, 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose exhibits excellent stability and compatibility with various protecting groups commonly used in carbohydrate chemistry. Its versatility and reliability make it a preferred choice for chemists working on the synthesis of structurally diverse carbohydrates and glycoconjugates.Overall, the strategic incorporation of 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose in chemical synthesis opens up avenues for the efficient assembly of complex molecules with precise control over stereochemistry and regioselectivity, making it an indispensable tool for synthetic chemists.