
Catalog Number	AR003H5H
Chemical Name	2-Amino-5-bromo-4-hydroxy-6-phenylpyrimidine
CAS Number	56741-95-8
Molecular Formula	C10H8BrN3O
Molecular Weight	266.094
MDL Number	MFCD00813905
SMILES	O=c1nc(N)[nH]c(c1Br)c1ccccc1
NSC Number	149027

2-Amino-5-bromo-4-hydroxy-6-phenylpyrimidine is a versatile compound that finds extensive application in chemical synthesis. This compound is particularly valued for its role as a key intermediate in the synthesis of pharmaceuticals and agrochemicals. By serving as a building block in organic synthesis, it enables the creation of complex molecules with specific biological activities.Due to its unique structure and reactivity, 2-Amino-5-bromo-4-hydroxy-6-phenylpyrimidine can participate in a variety of synthetic transformations, allowing chemists to introduce functional groups and modify the properties of target molecules. Its presence in synthesis routes contributes to the efficient production of important compounds, including potential drug candidates and crop protection agents.Chemists often rely on the versatility of 2-Amino-5-bromo-4-hydroxy-6-phenylpyrimidine to enable the construction of diverse chemical structures with desired characteristics. Whether used in the development of novel pharmaceuticals or the design of new materials, this compound plays a crucial role in advancing the field of chemical synthesis.