
Catalog Number	AR00EDER
Chemical Name	1,3-Dibromo-5-octyl-4h-thieno[3,4-c]pyrrole-4,6(5h)-dione
CAS Number	566939-58-0
Molecular Formula	C14H17Br2NO2S
Molecular Weight	423.1633
MDL Number	MFCD18804055
SMILES	CCCCCCCCN1C(=O)c2c(C1=O)c(sc2Br)Br

1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione, also known as $name$, is a versatile compound that finds wide application in chemical synthesis. This molecule serves as a valuable building block in the creation of various functionalized materials and organic compounds due to its unique structure and reactivity. In chemical synthesis, $name$ can be employed as a key intermediate in the preparation of organic semiconductors, dyes, and conjugated polymers. Its bromine substituents and heterocyclic framework enable it to participate in a range of important reactions such as cross-coupling, cycloaddition, and oxidation processes. Additionally, the octyl side chain provides $name$ with enhanced solubility and compatibility in various solvents and matrices, making it an ideal candidate for incorporation into complex molecular architectures. By utilizing $name$ in synthetic pathways, chemists can access new functional materials with tailored properties for applications in organic electronics, optoelectronics, and materials science.