
Catalog Number	AR00EEHH
Chemical Name	4-[(4-Methylbenzyl)oxy]benzenecarboxylic acid
CAS Number	56442-19-4
Molecular Formula	C15H14O3
Molecular Weight	242.2699
MDL Number	MFCD00625986
SMILES	Cc1ccc(cc1)COc1ccc(cc1)C(=O)O

4-((4-Methylbenzyl)oxy)benzoic acid is a versatile compound that finds wide application in chemical synthesis. It serves as a crucial building block in the development of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties. In organic synthesis, it acts as a key intermediate in the preparation of biologically active compounds by participating in esterification, amidation, and other reactions. This compound plays a vital role in the design and synthesis of novel molecules with improved efficacy and selectivity, making it an indispensable tool for medicinal chemistry and materials science researchers. By incorporating 4-((4-Methylbenzyl)oxy)benzoic acid into synthetic pathways, chemists can access a diverse range of functionalized derivatives with tailored properties, paving the way for the discovery of new drugs, agricultural chemicals, and advanced materials.