
Catalog Number	AR00E7U9
Chemical Name	2-methyl-6-nitrobenzene-1-sulfonyl chloride
CAS Number	56202-22-3
Molecular Formula	C7H6ClNO4S
Molecular Weight	235.6448
MDL Number	MFCD11505491
SMILES	[O-][N+](=O)c1cccc(c1S(=O)(=O)Cl)C

2-Methyl-6-nitrobenzene-1-sulfonyl chloride is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in organic chemistry due to its ability to act as a sulfonylating agent. In chemical reactions, 2-Methyl-6-nitrobenzene-1-sulfonyl chloride can be utilized for introducing the sulfonyl group into various organic molecules. This reaction is highly valuable in the synthesis of pharmaceuticals, agrochemicals, and functional materials. The sulfonyl group is known for its stability and unique reactivity, making it an important functional group in organic chemistry.Moreover, 2-Methyl-6-nitrobenzene-1-sulfonyl chloride is also employed in the construction of complex molecules through sulfonamide formation reactions. These reactions are commonly used in medicinal chemistry for designing bioactive compounds and drug candidates.Overall, the application of 2-Methyl-6-nitrobenzene-1-sulfonyl chloride in chemical synthesis showcases its significance as a key building block for creating diverse organic compounds with specific functionalities.