
Catalog Number	AR003NGF
Chemical Name	2-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid
CAS Number	56059-30-4
Molecular Formula	C6H5FN2O4
Molecular Weight	188.11330320000002
MDL Number	MFCD00832183
SMILES	OC(=O)Cn1cc(F)c(=O)[nH]c1=O

2-(5-Fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid is a versatile compound widely utilized in chemical synthesis for its unique reactivity and functional group compatibility. This compound serves as a valuable building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, 2-(5-Fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid acts as a key intermediate in the formation of heterocyclic compounds through cyclization reactions. Its structural properties make it a suitable precursor for the creation of diverse nitrogen-containing ring systems, which are essential in the development of bioactive molecules and complex organic compounds.Furthermore, the presence of a fluoro substituent in the structure of 2-(5-Fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid enhances its reactivity and allows for specific fluorination reactions, enabling the introduction of fluorine atoms into target molecules. This fluorinated derivative can exhibit unique pharmacological properties or improved biological activity compared to non-fluorinated analogs, making it a valuable tool in medicinal chemistry and drug discovery.Overall, the strategic incorporation of 2-(5-Fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid in chemical synthesis offers researchers a powerful means to access structurally diverse and biologically relevant compounds with potential applications in various fields of chemistry and drug development.