
Catalog Number	AR00JIAG
Chemical Name	2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid
CAS Number	56011-75-7
Molecular Formula	C10H10O4
Molecular Weight	194.184
MDL Number	MFCD01463470
SMILES	OC(=O)c1ccc2c(c1)OC(O2)(C)C

2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. This particular compound plays a crucial role in the field of organic chemistry due to its unique structure and reactivity.One key application of 2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid is its use as a building block in the synthesis of various pharmaceuticals and agrochemicals. By incorporating this compound into a synthetic route, chemists can introduce specific functional groups and stereochemical features that are essential for the desired biological activity of the final product.Furthermore, 2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid can also serve as a precursor in the preparation of advanced materials, such as polymers, dyes, and flavor compounds. Its reactivity allows for the creation of complex molecular structures with tailored properties, making it an indispensable tool in the development of new materials with enhanced functionality.Overall, the versatility and reactivity of 2,2-Dimethyl-1,3-benzodioxole-5-carboxylic acid make it a valuable component in various chemical synthesis processes, enabling the creation of novel compounds with a wide range of applications in both the pharmaceutical and materials science industries.