
Catalog Number	AR00IAOD
Chemical Name	24,25,26-Trinoroleanan-3-one, 5,9,13-trimethyl-,(4b,5b,8a,9b,10a,13a,14b)-
CAS Number	559-74-0
Molecular Formula	C30H50O
Molecular Weight	426.7174
MDL Number	MFCD00017296
SMILES	O=C1CC[C@@H]2[C@]([C@H]1C)(C)CC[C@H]1[C@@]2(C)CC[C@@]2([C@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C)C

Friedelin is a naturally occurring triterpenoid compound with a wide range of applications in chemical synthesis. In the field of organic chemistry, Friedelin serves as a valuable starting material for the synthesis of various derivatives and can be used as a precursor in the production of pharmaceuticals, cosmetics, and agrochemicals. Its unique structure and reactivity make it ideal for the construction of complex molecules through various chemical transformations. Additionally, Friedelin can be utilized as a building block for the development of novel materials with specialized properties, making it a versatile and indispensable compound in the realm of chemical synthesis.