
Catalog Number	AR00DCEA
Chemical Name	PROFLAVINE
CAS Number	553-30-0
Molecular Formula	C13H13N3O4S
Molecular Weight	307.32501999999994
MDL Number	MFCD00185879
SMILES	OS(=O)(=O)O.Nc1ccc2c(c1)nc1c(c2)ccc(c1)N

3,6-Acridinediamine, sulfate (1:1) is a versatile compound that finds wide application in chemical synthesis processes. With its unique structure and properties, this compound serves as a valuable building block in the creation of various organic compounds. One of the key applications of 3,6-Acridinediamine, sulfate (1:1) is in the synthesis of pharmaceutical intermediates. Its ability to participate in diverse transformations makes it a crucial component in the production of potential drug candidates. Additionally, this compound is utilized in the preparation of optical brightening agents, which are essential additives in the textile and paper industries. Furthermore, 3,6-Acridinediamine, sulfate (1:1) plays a significant role in the development of fluorescent dyes and materials due to its fluorescent properties. Its incorporation in the synthesis of these materials enables the production of various fluorescent probes and markers used in biological and materials science research.