
Catalog Number	AR00DATZ
Chemical Name	Tectorigenin
CAS Number	548-77-6
Molecular Formula	C16H12O6
Molecular Weight	300.26288
MDL Number	MFCD00597094
SMILES	COc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O

Tectorigenin, a natural compound derived from certain plant sources, has found valuable applications in chemical synthesis. Its unique chemical structure and reactivity make it a valuable starting material for the synthesis of various complex organic compounds. Chemists often utilize tectorigenin as a key building block in the production of novel pharmaceuticals, agrochemicals, and functional materials. By strategically modifying the functional groups on tectorigenin through synthetic transformations, researchers can access a diverse array of derivatives with enhanced properties and biological activities. Additionally, tectorigenin's compatibility with various synthetic methodologies further expands its utility in the creation of target molecules with specific structural motifs. This versatile compound plays a vital role in advancing the field of organic synthesis and drug discovery, offering exciting possibilities for the development of innovative chemical entities.