
Catalog Number	AR00DBY8
Chemical Name	Suloctidil
CAS Number	54767-75-8
Molecular Formula	C20H35NOS
Molecular Weight	337.563
MDL Number	MFCD03548034
SMILES	CCCCCCCCN[C@@H]([C@H](c1ccc(cc1)SC(C)C)O)C

Suloctidil, a versatile compound used in chemical synthesis, is a potent inhibitor of platelet aggregation. This property makes it a valuable tool in the development of medications aimed at preventing or treating conditions related to abnormal blood clotting. In the field of organic chemistry, Suloctidil is commonly employed as a reagent in the synthesis of various heterocyclic compounds, particularly those with pharmacological relevance.Its function as a platelet aggregation inhibitor allows Suloctidil to act as a crucial building block in the creation of novel drug candidates targeting cardiovascular diseases, coagulation disorders, and other related conditions. By incorporating Suloctidil into synthetic pathways, chemists can modify its structure to enhance its biological activity or improve its pharmacokinetic properties, ultimately leading to the development of more effective therapeutic agents.Additionally, Suloctidil's unique chemical properties make it a versatile tool in the construction of complex molecular frameworks, serving as a key intermediate in the synthesis of diverse pharmaceuticals and biologically active molecules. Its role in chemical synthesis extends beyond drug discovery, finding applications in the preparation of biologically relevant compounds for research and industrial purposes.