
Catalog Number	AR00IAG8
Chemical Name	Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-, (1S,4R,5R)-
CAS Number	546-80-5
Molecular Formula	C10H16O
Molecular Weight	152.2334
MDL Number	MFCD00001313
SMILES	O=C1C[C@]2([C@@H]([C@H]1C)C2)C(C)C

Thujone is a naturally occurring ketone found in various plants, most notably in the herbs wormwood, sage, and tansy. Known for its distinct aroma and flavor, Thujone has been a valuable component in the field of chemical synthesis. In organic chemistry, Thujone has shown potential as a building block for the creation of complex molecules due to its unique structure and reactivity. Its presence in essential oils has also made it a key ingredient in the manufacturing of fragrances, flavorings, and pharmaceuticals. Furthermore, Thujone's properties have been utilized in the synthesis of pharmaceutical drugs and as a precursor in the production of fine chemicals. This versatile compound continues to play a significant role in various chemical processes, showcasing its importance in the realm of synthesis.