
Catalog Number	AR00DG0S
Chemical Name	Cimbuterol
CAS Number	54239-39-3
Molecular Formula	C13H19N3O
Molecular Weight	233.3095
MDL Number	MFCD16652572
SMILES	N#Cc1cc(ccc1N)C(CNC(C)(C)C)O

Cimbuterol, also known as clenbuterol, is a potent beta2-adrenergic agonist that finds application in chemical synthesis as a selective stimulant of beta2-adrenergic receptors. In organic chemistry, it is commonly used as a reagent for its ability to activate these receptors, leading to a variety of biological responses. Cimbuterol's unique properties make it a valuable tool in research and pharmaceutical development, where its role in activating beta2-adrenergic receptors can be harnessed to study cellular signaling pathways and investigate potential therapeutic targets. Additionally, its use in chemical synthesis contributes to the development of new compounds and pharmaceuticals with targeted physiological effects.