
Catalog Number	AR00D8OB
Chemical Name	2-[[(2R)-6,7-Dichloro-2-cyclopentyl-2,3-dihydro-2-methyl-1-oxo-1H-inden-5-yl]oxy]acetic acid
CAS Number	54197-31-8
Molecular Formula	C17H18Cl2O4
Molecular Weight	357.2284199999999
MDL Number	MFCD28133534
SMILES	OC(=O)COc1cc2C[C@](C(=O)c2c(c1Cl)Cl)(C)C1CCCC1

2-[[(2R)-6,7-Dichloro-2-cyclopentyl-2,3-dihydro-2-methyl-1-oxo-1H-inden-5-yl]oxy]acetic acid, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. In chemical synthesis, $name$ plays a crucial role as a starting material for the synthesis of complex organic molecules. Its unique structure and reactivity allow for the introduction of functional groups and stereochemistry control, making it an indispensable tool for synthetic chemists aiming to design and create novel compounds with specific properties and biological activities. Additionally, $name$ exhibits excellent stability and compatibility with a wide range of reaction conditions, further enhancing its utility in the synthesis of diverse chemical entities. The application of 2-[[(2R)-6,7-Dichloro-2-cyclopentyl-2,3-dihydro-2-methyl-1-oxo-1H-inden-5-yl]oxy]acetic acid in chemical synthesis opens up opportunities for innovative research and development in the fields of medicinal chemistry, materials science, and beyond.