
Catalog Number	AR00JL7G
Chemical Name	Thimerosal
CAS Number	54-64-8
Molecular Formula	C9H9HgNaO2S
Molecular Weight	404.8113
MDL Number	MFCD00013062
SMILES	CC[Hg]Sc1ccccc1C(=O)[O-].[Na+]
UN Number	2025

The Ethylmercury thiosalicylic acid sodium salt plays a crucial role in chemical synthesis as a versatile reagent with unique properties. Widely used in organic chemistry, this compound serves as a potent nucleophilic agent for various reactions, including thiol-disulfide exchange, S-alkylation, and metal chelation. Additionally, it is known for its ability to form stable complexes with heavy metals, making it an essential part of catalytic processes. Its application extends to pharmaceutical synthesis, where it can aid in the formation of complex molecular structures and functional groups. In summary, the Ethylmercury thiosalicylic acid sodium salt is a valuable tool for chemists seeking efficient and selective methods in their synthetic endeavors.