
Catalog Number	AR00IA70
Chemical Name	1,2-Cyclopropanedicarboxylic acid, mono(phenylmethyl) ester, cis-
CAS Number	53229-58-6
Molecular Formula	C12H12O4
Molecular Weight	220.2213
MDL Number	MFCD29060207
SMILES	O=C([C@@H]1C[C@@H]1C(=O)O)OCc1ccccc1

Cis-2-((Benzyloxy)carbonyl)cyclopropanecarboxylic acid is a critical intermediate in chemical synthesis, prized for its unique reactivity in forming intricate molecular structures. This compound serves as a versatile building block in the creation of complex organic molecules through the synthesis of pharmaceuticals, agrochemicals, and materials. With its distinctive cyclopropane ring and benzyloxy carbonyl group, this compound facilitates the construction of diverse molecular architectures with precise stereochemistry and functional group compatibility. Its strategic incorporation into synthetic pathways allows for the efficient assembly of target molecules with high selectivity and yield, making it a valuable tool for chemists in the design and production of novel compounds for various applications.