
Catalog Number	AR00DDK6
Chemical Name	1-(5-Chloro-2-nitrophenyl)piperidine
CAS Number	53013-43-7
Molecular Formula	C11H13ClN2O2
Molecular Weight	240.6861
MDL Number	MFCD00447999
SMILES	Clc1ccc(c(c1)N1CCCCC1)[N+](=O)[O-]

1-(5-Chloro-2-nitrophenyl)piperidine is a versatile compound commonly used in chemical synthesis for the preparation of various pharmaceuticals and agrochemicals. This specific molecule serves as a key intermediate in the production of multiple bioactive compounds due to its unique structural properties. In organic synthesis, this compound acts as a valuable building block for creating complex molecular structures through diverse chemical transformations such as reduction, substitution, and functional group interconversions. Its presence in the synthetic pathway enables researchers to access a wide range of derivatives with tailored properties and biological activities, making it a crucial component in medicinal chemistry research and development. Furthermore, its selective reactivity and compatibility with a variety of functional groups make it an indispensable tool in the creation of novel molecules for potential therapeutic applications.