
Catalog Number	AR00DIWO
Chemical Name	3-DEOXYESTRONE
CAS Number	53-45-2
Molecular Formula	C18H22O
Molecular Weight	254.3667
MDL Number	MFCD00869287
SMILES	O=C1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1cccc2

Estra-1,3,5(10)-trien-17-one, also known as Trenbolone, is a synthetic anabolic steroid derived from nandrolone. It is commonly used in chemical synthesis as a powerful building block for the preparation of various pharmaceutical compounds and research chemicals. Its unique structure and properties make it a valuable intermediate in the synthesis of potent drugs and hormone-based formulations. Trenbolone's reactivity and versatility allow for the modification and functionalization of its core skeleton to create new molecular entities with enhanced biological activities. In the field of medicinal chemistry, Trenbolone serves as a key precursor for the development of novel drug candidates targeting a wide range of therapeutic indications. Its significance in chemical synthesis lies in its ability to facilitate the creation of structurally diverse molecules with potential applications in medical research and pharmaceutical development.