
Catalog Number	AR01CDAM
Chemical Name	Pregnan-20-one, 3,11,17,21-tetrahydroxy-, (3a,5b,11b)-
CAS Number	53-02-1
Molecular Formula	C21H34O5
Molecular Weight	366.4917
MDL Number	MFCD00067597
SMILES	OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@H](C2)O
NSC Number	57431

Tetrahydrocortisol, also known as THF, is a key intermediate in the synthesis of various corticosteroids and other pharmaceutical compounds. This versatile compound is widely utilized in chemical reactions to introduce specific functional groups and modify the structure of molecules. In the field of chemical synthesis, Tetrahydrocortisol acts as a crucial building block for creating synthetic analogs of natural hormones, such as cortisol. By incorporating Tetrahydrocortisol into synthetic pathways, chemists can manipulate the biological activity, pharmacokinetics, and other properties of the resulting compounds. Furthermore, its unique structural features make it a valuable tool for designing novel pharmaceuticals with improved therapeutic effects and reduced side effects. The application of Tetrahydrocortisol in chemical synthesis exemplifies its importance in the pharmaceutical industry and underscores its role in advancing drug discovery and development processes.