
Catalog Number	AR00DBY0
Chemical Name	OXELADIN CITRATE
CAS Number	52432-72-1
Molecular Formula	C26H41NO10
Molecular Weight	527.6044
MDL Number	MFCD00027040
SMILES	OC(=O)CC(C(=O)O)(CC(=O)O)O.CCN(CCOCCOC(=O)C(c1ccccc1)(CC)CC)CC
NSC Number	759231

Oxeladin citrate, a pharmaceutical compound, plays a crucial role in chemical synthesis as a versatile intermediate. It is commonly utilized in the production of various cough and cold medications due to its potent antitussive properties. This compound serves as a crucial building block in the creation of these medications, allowing for the synthesis of effective remedies for respiratory conditions. Additionally, Oxeladin citrate's unique chemical structure enables it to be modified and functionalized in a controlled manner, making it a valuable tool in the development of novel pharmaceuticals. Its utility in chemical synthesis extends beyond the pharmaceutical industry, with applications in research and development for creating new compounds with diverse biological activities.