
Catalog Number	AR00DG2J
Chemical Name	O-Desmethylnaproxen
CAS Number	52079-10-4
Molecular Formula	C13H12O3
Molecular Weight	216.2326
MDL Number	MFCD00869765
SMILES	OC(=O)[C@H](c1ccc2c(c1)ccc(c2)O)C

The (S)-2-(6-Hydroxynaphthalen-2-yl)propanoic acid, also known as $name$, serves as a crucial chiral building block in chemical synthesis. This compound is widely utilized in asymmetric synthesis, where its stereochemistry plays a significant role in the formation of complex molecules with specific optical properties. (S)-2-(6-Hydroxynaphthalen-2-yl)propanoic acid is commonly employed in the production of pharmaceuticals, agrochemicals, and materials science due to its ability to introduce chirality in a controlled manner. Its incorporation in various synthetic routes enables the creation of enantiomerically pure compounds, essential in drug discovery and development processes. Additionally, this compound's versatile reactivity allows for the selective functionalization of molecules, resulting in tailored structures that exhibit desired properties.