
Catalog Number	AR00I9X9
Chemical Name	Cholestan-3-ol, (3a,5b)-
CAS Number	516-92-7
Molecular Formula	C27H48O
Molecular Weight	388.6694
MDL Number	MFCD00064143
SMILES	CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@H](C2)O)C)C
NSC Number	18182

Epicoprostanol, a derivative of the natural steroidal compound coprostanol, finds versatile applications in chemical synthesis due to its unique structural properties. In organic chemistry, it serves as a valuable intermediate in the production of various pharmaceuticals, particularly those related to hormone modulation and steroidal drug development. The functional groups present in epicoprostanol enable facile derivatization, making it an essential building block in the creation of novel molecules with therapeutic potential. Its incorporation in synthetic routes allows for the efficient construction of complex structures, facilitating research in medicinal chemistry and drug discovery. Furthermore, the reactivity of epicoprostanol under various conditions makes it a valuable tool for the preparation of diverse chemical entities, showcasing its significance in advancing synthetic methodologies and enabling the production of bioactive compounds with promising biological activities.