
Catalog Number	AR00DAEK
Chemical Name	1,3,4,6-TETRACHLORO-3ALPHA,6ALPHA-DI-PHENYLGLYCOURIL
CAS Number	51592-06-4
Molecular Formula	C16H10Cl4N4O2
Molecular Weight	432.0882
MDL Number	MFCD00027367
SMILES	ClN1C(=O)N(C2(C1(c1ccccc1)N(Cl)C(=O)N2Cl)c1ccccc1)Cl

Iodogen is a widely used reagent in chemical synthesis, particularly in the field of organic chemistry. It is primarily utilized for the radioiodination of various molecules, such as proteins, peptides, and nucleic acids. This reaction involves the substitution of a hydrogen atom with an iodine atom, which is essential for labeling compounds for various research applications.Additionally, Iodogen is commonly employed in the preparation of radioiodinated radiopharmaceuticals for use in nuclear medicine imaging studies. Its efficiency and selectivity make it a preferred choice for introducing radioactive iodine isotopes into molecules, allowing for the study of biological processes in vivo.Furthermore, Iodogen is utilized in the synthesis of iodinated compounds for pharmaceutical purposes, enabling the development of new drugs and diagnostic agents. Its versatility and compatibility with a wide range of molecules make it a valuable tool in medicinal chemistry research.Overall, Iodogen plays a crucial role in chemical synthesis by facilitating the introduction of iodine atoms into molecules with high precision and efficiency, making it an indispensable reagent in various scientific fields.