
Catalog Number	AR00DGP2
Chemical Name	(4-Methylphenyl)-1-(2H)-phthalazinone
CAS Number	51334-85-1
Molecular Formula	C15H12N2O
Molecular Weight	236.26858000000001
MDL Number	MFCD00222976
SMILES	Cc1ccc(cc1)c1n[nH]c(=O)c2c1cccc2

4-(p-Tolyl)phthalazin-1(2H)-one is a versatile compound that finds wide application in chemical synthesis. Known for its unique structural properties, this molecule serves as a key building block in the creation of various organic compounds.In chemical synthesis, 4-(p-Tolyl)phthalazin-1(2H)-one plays a crucial role as a precursor in the production of complex heterocyclic structures. Its reactivity and functional groups make it a valuable starting material for the synthesis of diverse organic molecules, including pharmaceuticals, agrochemicals, and materials.By leveraging the properties of 4-(p-Tolyl)phthalazin-1(2H)-one, chemists can access a wide range of chemical transformations, such as functional group modifications, ring-closure reactions, and intermolecular coupling processes. This compound's versatility and compatibility with multiple synthetic pathways make it a valuable tool in the creation of novel chemical entities with potential applications across various industries.