
Catalog Number	AR00DBX1
Chemical Name	Aconine
CAS Number	509-20-6
Molecular Formula	C25H41NO9
Molecular Weight	499.5943
MDL Number	MFCD01673464
SMILES	COC[C@@]12CN(CC)C3C4([C@@H]2[C@@H](OC)C3[C@@]2([C@@H]3[C@H]4C[C@@]([C@@H]3O)([C@H]([C@@H]2O)OC)O)O)[C@H](C[C@H]1O)OC

Aconine, a natural alkaloid found in various plants, plays a significant role in chemical synthesis as a versatile building block. Its unique chemical structure and reactivity make it an essential component in creating pharmaceutically active compounds, agrochemicals, and advanced materials. Aconine is particularly valued in organic synthesis for its ability to participate in diverse chemical transformations, including acylation, alkylation, and cyclization reactions. This flexibility makes it an indispensable tool for the creation of complex molecular structures with high efficiency and precision. Additionally, aconine's presence in natural sources provides a sustainable and environmentally friendly source for the production of valuable chemical products.