
Catalog Number	AR00DMS5
Chemical Name	1-p-chlorobenzyl-1H-indazole-3-carboxylic acid
CAS Number	50264-86-3
Molecular Formula	C15H11ClN2O2
Molecular Weight	286.71304
MDL Number	MFCD01719761
SMILES	Clc1ccc(cc1)Cn1nc(c2c1cccc2)C(=O)O

1-(4-Chlorobenzyl)-1H-indazole-3-carboxylic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. With its unique structure and properties, this compound is commonly utilized in the development of novel pharmaceuticals, agrochemicals, and materials.In chemical synthesis, $name$ can be employed as a key intermediate in the preparation of various bioactive molecules. Its functional groups and reactivity allow for the modification and functionalization of the indazole core, enabling the synthesis of diverse analogs with improved biological activities.Moreover, $name$ serves as a valuable precursor for the construction of heterocyclic scaffolds, which are essential motifs in medicinal chemistry. By incorporating this compound into multi-step synthetic routes, chemists can access a wide range of structurally complex compounds with potential applications in drug discovery and development.Overall, the strategic use of 1-(4-Chlorobenzyl)-1H-indazole-3-carboxylic acid in chemical synthesis enables the efficient and controlled assembly of intricate molecular architectures, making it a vital component in the synthesis of advanced compounds for various industrial sectors.