
Catalog Number	AR0037VY
Chemical Name	4,4'-Biphenyldione
CAS Number	494-72-4
Molecular Formula	C12H8O2
Molecular Weight	184.1907
MDL Number	MFCD00859193
SMILES	O=C1C=CC(=C2C=CC(=O)C=C2)C=C1

4,4'-Biphenyldione, also known as benzil, is a versatile compound that finds widespread application in chemical synthesis. Its unique molecular structure makes it a valuable building block in the preparation of various organic compounds. In chemical synthesis, 4,4'-Biphenyldione is commonly used as a precursor for the synthesis of dyes, pharmaceuticals, and complex organic molecules. By undergoing various chemical reactions, such as reduction, oxidation, and condensation, 4,4'-Biphenyldione can be transformed into a range of functionalized derivatives with diverse properties and applications. Its reactivity and ability to participate in multi-step synthesis make it a valuable tool for organic chemists seeking to access novel compounds and materials.