
Catalog Number	AR01JS4Z
Chemical Name	ETHYL 1-PHENYL-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE
CAS Number	4915-97-3
Molecular Formula	C11H11N3O2
Molecular Weight	217.2239
MDL Number	MFCD01836533
SMILES	CCOC(=O)c1nnn(c1)c1ccccc1

ETHYL 1-PHENYL-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE, a key compound in chemical synthesis, is widely utilized as a versatile building block in the preparation of various organic molecules. Its unique structural properties make it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. With its 1,2,3-triazole ring and ester functional group, this compound is particularly important in the construction of complex molecular frameworks through click chemistry reactions and other strategic transformations. Its role in promoting the formation of diverse organic structures highlights its significance in modern synthetic methodologies, making it a crucial component in the toolbox of organic chemists worldwide.