
Catalog Number	AR006XII
Chemical Name	2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid
CAS Number	484-78-6
Molecular Formula	C10H12N2O4
Molecular Weight	224.2133
MDL Number	MFCD00047832
SMILES	OC(=O)C(CC(=O)c1cccc(c1N)O)N

2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis. This amino acid derivative is valued for its role in the creation of peptide bonds, which are essential for constructing proteins and other biological molecules. In chemical synthesis, $name$ serves as a key building block for the formation of peptides and proteins through solid-phase peptide synthesis (SPPS) and solution-phase peptide synthesis (SPPS). By reacting with other amino acids and peptide precursors, this compound plays a crucial role in the assembly of complex peptide structures with precise sequences. Its unique chemical properties enable the selective coupling of amino acids, leading to the synthesis of custom peptides tailored for various research and industrial applications.