
Catalog Number	AR006XIS
Chemical Name	Isatinic acid
CAS Number	484-38-8
Molecular Formula	C9H5NO4
Molecular Weight	191.1403
MDL Number	MFCD19301197
SMILES	O=C1c2ccccc2N(C1=O)C(=O)O

$name$ is a versatile compound commonly used in chemical synthesis due to its ability to undergo various reactions, making it a valuable building block in organic chemistry. One of its key applications is in the synthesis of heterocyclic compounds, where $name$ serves as a precursor or intermediate in the production of pharmaceuticals, dyes, and other fine chemicals. This compound is particularly important in the preparation of indoles, which are a class of compounds with pharmacological and biological significance. Additionally, $name$ can be utilized in the preparation of complex molecules through its involvement in condensation reactions, cyclization processes, and as a starting material for the synthesis of diverse chemical structures.