
Catalog Number	AR00D9IW
Chemical Name	Retrorsine
CAS Number	480-54-6
Molecular Formula	C18H25NO6
Molecular Weight	351.3942
MDL Number	MFCD00870195
SMILES	CC=C1CC(C)C(O)(CO)C(=O)OCC2=CCN3C2C(OC1=O)CC3

Retrorsine, a natural compound derived from certain plants, plays a crucial role in chemical synthesis as a key building block for the creation of various organic molecules. In the realm of chemistry, Retrorsine is utilized in the synthesis of complex compounds and pharmaceuticals due to its unique chemical properties. Its ability to form bonds with other molecules makes it an essential reagent in the creation of novel substances with specific functions and properties. The controlled use of Retrorsine in chemical reactions allows chemists to manipulate molecular structures and create compounds with desired characteristics, serving as a valuable tool in the development of new materials and drugs.