
Catalog Number	AR00I8TX
Chemical Name	Ginsenoside Rb1
CAS Number	41753-43-9
Molecular Formula	C54H92O23
Molecular Weight	1109.2945
MDL Number	MFCD00133367
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)(CCC=C(C)C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Ginsenoside Rb1 is a naturally occurring compound found in ginseng plants, particularly in Panax ginseng. In chemical synthesis, Ginsenoside Rb1 can serve as a valuable precursor for the production of various derivative compounds due to its unique structure and functional groups. One of the key applications of Ginsenoside Rb1 in chemical synthesis is its potential as a starting material for the synthesis of novel drug candidates. By selectively modifying the structure of Ginsenoside Rb1 through chemical reactions, researchers can create analogs with improved pharmacological properties, such as increased bioavailability or enhanced therapeutic effects. This approach allows for the development of new pharmaceuticals with potential benefits for various medical conditions.Additionally, Ginsenoside Rb1 can be utilized in the synthesis of bioactive compounds for use in traditional medicine or dietary supplements. Through strategic chemical transformations, researchers can access derivatives of Ginsenoside Rb1 that exhibit different biological activities, such as anti-inflammatory, antioxidant, or neuroprotective properties. These modified compounds may offer potential alternatives for treating various health conditions or promoting overall well-being.Overall, the application of Ginsenoside Rb1 in chemical synthesis offers a promising pathway for developing new drug candidates and bioactive compounds with potential therapeutic benefits. By harnessing the unique properties of Ginsenoside Rb1 in synthetic transformations, researchers can expand the scope of its biological activities and explore its potential in various areas of medicine and nutrition.