
Catalog Number	AR003QDP
Chemical Name	Dioctyl fumarate
CAS Number	2997-85-5
Molecular Formula	C20H36O4
Molecular Weight	340.4974
MDL Number	MFCD00137329
SMILES	CCCCCCCCOC(=O)/C=C/C(=O)OCCCCCCCC

Dioctyl fumarate is a versatile compound commonly used in chemical synthesis as a plasticizer and polymer additive. Its ability to improve the flexibility, durability, and overall performance of polymers makes it a valuable ingredient in the production of various industrial and consumer products. In chemical synthesis, dioctyl fumarate serves as a vital component in the creation of specialty resins, adhesives, coatings, and other materials that require enhanced mechanical and thermal properties. Its compatibility with a wide range of polymers and its efficient plasticizing effects make it an essential tool for formulators seeking to optimize the properties of their products. Additionally, dioctyl fumarate's low volatility and excellent resistance to heat and chemicals further enhance its utility in diverse industrial applications.