
Catalog Number	AR00C54C
Chemical Name	3β-Hydroxy-5α-lanosta-7,9(11),24-trien-21-oic acid
CAS Number	29220-16-4
Molecular Formula	C30H46O3
Molecular Weight	454.68443999999994
MDL Number	MFCD22125011
SMILES	CC(=CCC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C(=O)O)C

Lanosta-7,9(11),24-trien-21-oic acid, 3-hydroxy-, (3β)- is a valuable compound in chemical synthesis due to its potential applications. This compound can serve as a precursor in the creation of various pharmaceuticals, particularly those targeting cholesterol regulation and inflammation. Its unique structure and functional groups make it a versatile building block for synthesizing novel molecules with potential therapeutic properties. In addition, Lanosta-7,9(11),24-trien-21-oic acid, 3-hydroxy-, (3β)- can be utilized in the development of new materials or as a starting material for the production of specialty chemicals. Its involvement in chemical synthesis opens up a wide range of possibilities for advancements in drug discovery and material science.