
Catalog Number	AR00ARKZ
Chemical Name	[2',4'-Bis(1,1-dimethylethyl)-6'-methoxy[1,1'-biphenyl]-2-yl]dicyclohexylphosphine
CAS Number	1848244-75-6
Molecular Formula	C33H49OP
Molecular Weight	492.7153
MDL Number	MFCD30184625
SMILES	COc1cc(cc(c1c1ccccc1P(C1CCCCC1)C1CCCCC1)C(C)(C)C)C(C)(C)C

[2',4'-Bis(1,1-dimethylethyl)-6'-methoxy[1,1'-biphenyl]-2-yl]dicyclohexylphosphine, also known as $name$, is a versatile and valuable reagent in chemical synthesis. This compound is widely used as a ligand in organometallic catalysis, particularly in transition metal-catalyzed reactions.$name$ plays a crucial role in promoting various chemical transformations, such as cross-coupling reactions and asymmetric hydrogenation. Its unique structure and steric properties enhance the selectivity and efficiency of these reactions, making it an indispensable tool for synthetic chemists.In addition, $name$ has found applications in the synthesis of complex natural products and pharmaceuticals. Its ability to modulate the reactivity of metal catalysts enables the stereoselective formation of challenging chemical bonds, leading to the streamlined and efficient synthesis of biologically active molecules.Overall, $name$ is a valuable reagent that enables the development of new synthetic methodologies and facilitates the preparation of complex molecules with high efficiency and selectivity.