
Catalog Number	AR00283A
Chemical Name	PHOSPHONIC ACID, P-METHYL-, MONO(4-NITROPHENYL) ESTER
CAS Number	1832-64-0
Molecular Formula	C7H8NO5P
Molecular Weight	217.1159
MDL Number	MFCD32206322
SMILES	[O-][N+](=O)c1ccc(cc1)OP(=O)(O)C

4-Nitrophenyl hydrogen P-methylphosphonate is a versatile compound that finds wide application in chemical synthesis. Due to its unique chemical structure and reactivity, this compound serves as a valuable intermediate in the creation of various organic molecules. In the realm of chemical synthesis, it is commonly used as a starting material for the preparation of phosphonate esters, which are important building blocks in the synthesis of pharmaceuticals, agrochemicals, and various other fine chemicals. Additionally, 4-Nitrophenyl hydrogen P-methylphosphonate can be utilized in the development of new materials and as a key reagent in organophosphorus chemistry. Its ability to participate in diverse chemical reactions makes it a crucial component in the toolbox of synthetic chemists looking to access complex molecules efficiently and selectively.