
Catalog Number	AR009G1U
Chemical Name	(2'-Amino-1,1'-biphenyl-2-yl)methanesulfonatopalladium(II) dimer
CAS Number	1435520-65-2
Molecular Formula	C26H26N2O6Pd2S2
Molecular Weight	739.4644400000002
MDL Number	MFCD22666044
SMILES	CS(=O)(=O)[O-]1[Pd+2]2([NH2]c3ccccc3C3=[C-]2C=CC=C3)[O-]([Pd+2]21[NH2]c1ccccc1C1=[C-]2C=CC=C1)S(=O)(=O)C

The (2'-Amino-1,1'-biphenyl-2-yl)methanesulfonatopalladium(II) dimer is a valuable catalyst widely utilized in chemical synthesis, particularly in the field of organic chemistry. This complex plays a crucial role in various transformations, such as cross-coupling reactions, C-H activation, and carbon-carbon bond formation. Its high catalytic activity and selectivity make it an essential tool for the efficient construction of complex molecules with significant synthetic utility. This catalyst provides chemists with a powerful means to access a diverse range of organic compounds and functional groups, enabling the rapid and precise assembly of intricate molecular architectures. Its versatility and reliability make it a key component in modern synthetic methodologies, facilitating the development of novel materials, pharmaceuticals, and fine chemicals.