
Catalog Number	AR00S4JU
Chemical Name	dimethyl({[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamoyl})amine
CAS Number	1301190-20-4
Molecular Formula	C14H23BN2O4S
Molecular Weight	326.2194
MDL Number	MFCD22572001
SMILES	CN(S(=O)(=O)Nc1cccc(c1)B1OC(C(O1)(C)C)(C)C)C

N,N-Dimethyl-N'-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamide is a versatile compound commonly used in chemical synthesis as a key reagent for the formation of carbon-nitrogen bonds. This compound acts as a valuable building block for the synthesis of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties and reactivity.In chemical synthesis, N,N-Dimethyl-N'-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamide is frequently employed in cross-coupling reactions, particularly in Suzuki-Miyaura coupling reactions. This reaction allows for the selective formation of arylamines, which are essential structural motifs in many biologically active compounds.Furthermore, this compound plays a crucial role in the preparation of functionalized sulfonamide derivatives, which have demonstrated significant pharmacological activities in the development of new drugs. Its ability to introduce specific functional groups into target molecules makes it a valuable tool for medicinal chemists and researchers in the pharmaceutical industry.Overall, N,N-Dimethyl-N'-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfamide is a highly useful compound in chemical synthesis, enabling the construction of complex organic molecules with diverse applications in drug discovery, materials science, and other areas of research.